C19H16BrCl2O3PS — CID 23617603
(4-bromo-2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-λ5-phosphane;phenol (PubChem CID 23617603) has the molecular formula C19H16BrCl2O3PS and a molecular weight of 506.19 g/mol. Its IUPAC name is (4-bromo-2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-λ5-phosphane;phenol.
| Compound Name | (4-bromo-2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-λ5-phosphane;phenol |
|---|---|
| PubChem CID | 23617603 |
| Molecular Formula | C19H16BrCl2O3PS |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 503.91 |
| IUPAC Name | (4-bromo-2,5-dichlorophenoxy)-methoxy-phenyl-sulfanylidene-λ5-phosphane;phenol |
| SMILES | COP(=S)(Oc1cc(Cl)c(Br)cc1Cl)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C13H10BrCl2O2PS.C6H6O/c1-17-19(20,9-5-3-2-4-6-9)18-13-8-11(15)10(14)7-12(13)16;7-6-4-2-1-3-5-6/h2-8H,1H3;1-5,7H |
| InChIKey | BATRCZWKDNOYDK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|