C14H9NO3 — CID 23617976
2-(3H-1,2-benzodioxol-6-yl)-1,3-benzoxazole (PubChem CID 23617976) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(3H-1,2-benzodioxol-6-yl)-1,3-benzoxazole.
| Compound Name | 2-(3H-1,2-benzodioxol-6-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 23617976 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(3H-1,2-benzodioxol-6-yl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc4c(c3)OOC4)nc2c1 |
| InChI | InChI=1S/C14H9NO3/c1-2-4-12-11(3-1)15-14(17-12)9-5-6-10-8-16-18-13(10)7-9/h1-7H,8H2 |
| InChIKey | MRLARRDBIJJOKM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|