C12H8O4 — CID 23618291
8H-pyrano[2,3-g]chromene-3,7-dione (PubChem CID 23618291) has the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. Its IUPAC name is 8H-pyrano[2,3-g]chromene-3,7-dione.
| Compound Name | 8H-pyrano[2,3-g]chromene-3,7-dione |
|---|---|
| PubChem CID | 23618291 |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 8H-pyrano[2,3-g]chromene-3,7-dione |
| SMILES | O=C1C=c2cc3c(cc2OC1)=CCC(=O)O3 |
| InChI | InChI=1S/C12H8O4/c13-9-3-8-5-11-7(1-2-12(14)16-11)4-10(8)15-6-9/h1,3-5H,2,6H2 |
| InChIKey | HKSCIRJARDVPPR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|