C13H14O3 — CID 123635829
7-ethylidene-6-propylidene-1,4-benzodioxin-2-one (PubChem CID 123635829) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 7-ethylidene-6-propylidene-1,4-benzodioxin-2-one.
| Compound Name | 7-ethylidene-6-propylidene-1,4-benzodioxin-2-one |
|---|---|
| PubChem CID | 123635829 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 7-ethylidene-6-propylidene-1,4-benzodioxin-2-one |
| SMILES | CC=c1cc2c(cc1=CCC)OCC(=O)O2 |
| InChI | InChI=1S/C13H14O3/c1-3-5-10-7-11-12(6-9(10)4-2)16-13(14)8-15-11/h4-7H,3,8H2,1-2H3 |
| InChIKey | OLORRYPDAVFBOU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|