C24H32N2O2 — CID 23627266
(2S,5S)-5-benzyl-1-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylpiperazine (PubChem CID 23627266) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2S,5S)-5-benzyl-1-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylpiperazine.
| Compound Name | (2S,5S)-5-benzyl-1-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 23627266 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (2S,5S)-5-benzyl-1-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylpiperazine |
| SMILES | COc1ccc(N2C[C@H](Cc3ccccc3)NC[C@@H]2C)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H32N2O2/c1-18-16-25-20(14-19-8-4-3-5-9-19)17-26(18)21-12-13-23(27-2)24(15-21)28-22-10-6-7-11-22/h3-5,8-9,12-13,15,18,20,22,25H,6-7,10-11,14,16-17H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | KOCPEPVBVOHQOZ-ICSRJNTNSA-N |
| XLogP | 4.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|