C23H29NO3 — CID 23627508
(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)morpholine (PubChem CID 23627508) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)morpholine.
| Compound Name | (2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)morpholine |
|---|---|
| PubChem CID | 23627508 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)morpholine |
| SMILES | COc1ccc(N2CCO[C@@H](Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H29NO3/c1-25-22-12-11-19(16-23(22)27-20-9-5-6-10-20)24-13-14-26-21(17-24)15-18-7-3-2-4-8-18/h2-4,7-8,11-12,16,20-21H,5-6,9-10,13-15,17H2,1H3/t21-/m0/s1 |
| InChIKey | DPHLCZRCXLCBAA-NRFANRHFSA-N |
| XLogP | 4.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|