C21H19N5O2S — CID 2362807
6-[2-prop-2-enylimino-3-(1-pyridin-2-ylethenylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 2362807) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 6-[2-prop-2-enylimino-3-(1-pyridin-2-ylethenylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-prop-2-enylimino-3-(1-pyridin-2-ylethenylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2362807 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 6-[2-prop-2-enylimino-3-(1-pyridin-2-ylethenylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | C=CC/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1NC(=C)c1ccccn1 |
| InChI | InChI=1S/C21H19N5O2S/c1-3-9-23-21-26(25-14(2)16-6-4-5-10-22-16)18(13-29-21)15-7-8-19-17(11-15)24-20(27)12-28-19/h3-8,10-11,13,25H,1-2,9,12H2,(H,24,27)/b23-21- |
| InChIKey | AGKVXZOPSAEGQE-LNVKXUELSA-N |
| XLogP | 3.24 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|