C24H30N4O2S — CID 2339732
6-[3-[[(4R)-4-tert-butylcyclohexen-1-yl]amino]-2-prop-2-enylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 2339732) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 6-[3-[[(4R)-4-tert-butylcyclohexen-1-yl]amino]-2-prop-2-enylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[[(4R)-4-tert-butylcyclohexen-1-yl]amino]-2-prop-2-enylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2339732 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 6-[3-[[(4R)-4-tert-butylcyclohexen-1-yl]amino]-2-prop-2-enylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | C=CC/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1NC1=CC[C@H](C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H30N4O2S/c1-5-12-25-23-28(27-18-9-7-17(8-10-18)24(2,3)4)20(15-31-23)16-6-11-21-19(13-16)26-22(29)14-30-21/h5-6,9,11,13,15,17,27H,1,7-8,10,12,14H2,2-4H3,(H,26,29)/b25-23-/t17-/m0/s1 |
| InChIKey | XZBTUDLDIFOMGF-KZIRDTCISA-N |
| XLogP | 4.91 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|