C16H24ClNO2SSi — CID 23630364
(2R)-N-[2-[(4-chlorophenyl)-dimethylsilyl]ethyl]-4-oxo-2-(sulfanylmethyl)pentanamide (PubChem CID 23630364) has the molecular formula C16H24ClNO2SSi and a molecular weight of 357.98 g/mol. Its IUPAC name is (2R)-N-[2-[(4-chlorophenyl)-dimethylsilyl]ethyl]-4-oxo-2-(sulfanylmethyl)pentanamide.
| Compound Name | (2R)-N-[2-[(4-chlorophenyl)-dimethylsilyl]ethyl]-4-oxo-2-(sulfanylmethyl)pentanamide |
|---|---|
| PubChem CID | 23630364 |
| Molecular Formula | C16H24ClNO2SSi |
| Molecular Weight | 357.98 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2R)-N-[2-[(4-chlorophenyl)-dimethylsilyl]ethyl]-4-oxo-2-(sulfanylmethyl)pentanamide |
| SMILES | CC(=O)C[C@@H](CS)C(=O)NCC[Si](C)(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO2SSi/c1-12(19)10-13(11-21)16(20)18-8-9-22(2,3)15-6-4-14(17)5-7-15/h4-7,13,21H,8-11H2,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | AZUFQGWGJLXAJY-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.98 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|