C21H20O6 — CID 23630380
3-cyclopentyloxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methylchromen-4-one (PubChem CID 23630380) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-cyclopentyloxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methylchromen-4-one.
| Compound Name | 3-cyclopentyloxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methylchromen-4-one |
|---|---|
| PubChem CID | 23630380 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-cyclopentyloxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methylchromen-4-one |
| SMILES | Cc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(OC3CCCC3)c(=O)c12 |
| InChI | InChI=1S/C21H20O6/c1-11-8-13(22)10-17-18(11)19(25)21(26-14-4-2-3-5-14)20(27-17)12-6-7-15(23)16(24)9-12/h6-10,14,22-24H,2-5H2,1H3 |
| InChIKey | XHRWXLUEBMVSOC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|