C20H23N3O2S — CID 23632050
benzyl 6-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoate (PubChem CID 23632050) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is benzyl 6-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoate.
| Compound Name | benzyl 6-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 23632050 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | benzyl 6-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]hexanoate |
| SMILES | Cc1csc2ncnc(NCCCCCC(=O)OCc3ccccc3)c12 |
| InChI | InChI=1S/C20H23N3O2S/c1-15-13-26-20-18(15)19(22-14-23-20)21-11-7-3-6-10-17(24)25-12-16-8-4-2-5-9-16/h2,4-5,8-9,13-14H,3,6-7,10-12H2,1H3,(H,21,22,23) |
| InChIKey | GVKSZLVBHUKVKO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|