C21H30N4O4S — CID 23634632
1-(1-adamantyl)-3-[[(2R,3S,5S)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]thiourea (PubChem CID 23634632) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[(2R,3S,5S)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[[(2R,3S,5S)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 23634632 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[[(2R,3S,5S)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cn([C@@H]2C[C@H](O)[C@@H](CNC(=S)NC34CC5CC(CC(C5)C3)C4)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H30N4O4S/c1-11-10-25(20(28)23-18(11)27)17-5-15(26)16(29-17)9-22-19(30)24-21-6-12-2-13(7-21)4-14(3-12)8-21/h10,12-17,26H,2-9H2,1H3,(H2,22,24,30)(H,23,27,28)/t12?,13?,14?,15-,16+,17-,21?/m0/s1 |
| InChIKey | ZFASYKLQZUYTHE-GAFAZNFXSA-N |
| XLogP | 0.93 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|