C25H13O6S2- — CID 23638642
1,1-dioxo-2-[(Z)-(1,1,3-trioxobenzo[f][1]benzothiol-2-ylidene)methyl]benzo[f][1]benzothiol-3-olate (PubChem CID 23638642) has the molecular formula C25H13O6S2- and a molecular weight of 473.51 g/mol. Its IUPAC name is 1,1-dioxo-2-[(Z)-(1,1,3-trioxobenzo[f][1]benzothiol-2-ylidene)methyl]benzo[f][1]benzothiol-3-olate.
| Compound Name | 1,1-dioxo-2-[(Z)-(1,1,3-trioxobenzo[f][1]benzothiol-2-ylidene)methyl]benzo[f][1]benzothiol-3-olate |
|---|---|
| PubChem CID | 23638642 |
| Molecular Formula | C25H13O6S2- |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 1,1-dioxo-2-[(Z)-(1,1,3-trioxobenzo[f][1]benzothiol-2-ylidene)methyl]benzo[f][1]benzothiol-3-olate |
| SMILES | O=C1/C(=C/C2=C([O-])c3cc4ccccc4cc3S2(=O)=O)S(=O)(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C25H14O6S2/c26-24-18-9-14-5-1-3-7-16(14)11-20(18)32(28,29)22(24)13-23-25(27)19-10-15-6-2-4-8-17(15)12-21(19)33(23,30)31/h1-13,26H/p-1/b23-13- |
| InChIKey | ZTZOOFREEJYMBC-QRVIBDJDSA-M |
| XLogP | 3.36 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|