C28H17O7S2- — CID 59061717
2-[(1E,3Z,5Z)-3-benzoyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1,1-dioxo-1-benzothiophen-3-olate (PubChem CID 59061717) has the molecular formula C28H17O7S2- and a molecular weight of 529.57 g/mol. Its IUPAC name is 2-[(1E,3Z,5Z)-3-benzoyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1,1-dioxo-1-benzothiophen-3-olate.
| Compound Name | 2-[(1E,3Z,5Z)-3-benzoyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1,1-dioxo-1-benzothiophen-3-olate |
|---|---|
| PubChem CID | 59061717 |
| Molecular Formula | C28H17O7S2- |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | 2-[(1E,3Z,5Z)-3-benzoyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1,1-dioxo-1-benzothiophen-3-olate |
| SMILES | O=C(C(=C\C=C1\C(=O)c2ccccc2S1(=O)=O)/C=C/C1=C([O-])c2ccccc2S1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C28H18O7S2/c29-26(18-8-2-1-3-9-18)19(14-16-24-27(30)20-10-4-6-12-22(20)36(24,32)33)15-17-25-28(31)21-11-5-7-13-23(21)37(25,34)35/h1-17,30H/p-1/b16-14+,19-15-,25-17- |
| InChIKey | RWXWJNNDLHKZAM-ULHNXDQJSA-M |
| XLogP | 3.42 |
| TPSA | 125.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|