C19H32O4Si — CID 23643175
trimethylsilyl 2-(8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enoate (PubChem CID 23643175) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is trimethylsilyl 2-(8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enoate.
| Compound Name | trimethylsilyl 2-(8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enoate |
|---|---|
| PubChem CID | 23643175 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | trimethylsilyl 2-(8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enoate |
| SMILES | C=CCC(C(=O)O[Si](C)(C)C)C1(C(=C)C)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C19H32O4Si/c1-7-8-16(17(20)23-24(4,5)6)18(15(2)3)9-11-19(12-10-18)21-13-14-22-19/h7,16H,1-2,8-14H2,3-6H3 |
| InChIKey | RUOACODGIHIHGW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|