C21H32O4 — CID 10970114
methyl (2R)-2-[(1'R,7'aR)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]-6-methylhept-5-enoate (PubChem CID 10970114) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (2R)-2-[(1'R,7'aR)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]-6-methylhept-5-enoate.
| Compound Name | methyl (2R)-2-[(1'R,7'aR)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 10970114 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (2R)-2-[(1'R,7'aR)-7'a-methylspiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene]-1'-yl]-6-methylhept-5-enoate |
| SMILES | COC(=O)[C@H](CCC=C(C)C)[C@H]1CC=C2CC3(CC[C@@]21C)OCCO3 |
| InChI | InChI=1S/C21H32O4/c1-15(2)6-5-7-17(19(22)23-4)18-9-8-16-14-21(24-12-13-25-21)11-10-20(16,18)3/h6,8,17-18H,5,7,9-14H2,1-4H3/t17-,18-,20+/m1/s1 |
| InChIKey | MRMBFCANHQKILV-GGPKGHCWSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|