About 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid
2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid (PubChem CID 23648128) has the molecular formula C20H14Br2O6
and a molecular weight of 510.13 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid |
| PubChem CID | 23648128 |
| Molecular Formula | C20H14Br2O6 |
| Molecular Weight | 510.13 g/mol |
| Exact Mass | 507.92 |
| IUPAC Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Br)c(Oc2ccc(O)c(Oc3cccc(O)c3)c2)c(Br)c1 |
| InChI | InChI=1S/C20H14Br2O6/c21-15-6-11(8-19(25)26)7-16(22)20(15)28-14-4-5-17(24)18(10-14)27-13-3-1-2-12(23)9-13/h1-7,9-10,23-24H,8H2,(H,25,26) |
| InChIKey | WCRWBJJFDPTIQX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.13 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid?
The IUPAC name of 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid (CID 23648128) is 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid is O=C(O)Cc1cc(Br)c(Oc2ccc(O)c(Oc3cccc(O)c3)c2)c(Br)c1.
What is the InChIKey of 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid?
The InChIKey is WCRWBJJFDPTIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Br2O6/c21-15-6-11(8-19(25)26)7-16(22)20(15)28-14-4-5-17(24)18(10-14)27-13-3-1-2-12(23)9-13/h1-7,9-10,23-24H,8H2,(H,25,26).
What are the key properties of 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid?
2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid has a molecular weight of 510.13 g/mol, XLogP of 5.83, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dibromo-4-[4-hydroxy-3-(3-hydroxyphenoxy)phenoxy]phenyl]acetic acid is sourced from PubChem (CID 23648128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).