C26H38F3N3O5 — CID 23648374
[(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-1-[4-(trifluoromethoxy)anilino]pentan-2-yl]carbamate (PubChem CID 23648374) has the molecular formula C26H38F3N3O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-1-[4-(trifluoromethoxy)anilino]pentan-2-yl]carbamate.
| Compound Name | [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-1-[4-(trifluoromethoxy)anilino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 23648374 |
| Molecular Formula | C26H38F3N3O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-1-[4-(trifluoromethoxy)anilino]pentan-2-yl]carbamate |
| SMILES | CCC[C@@H](CNc1ccc(OC(F)(F)F)cc1)NC(=O)O[C@@H](CC1CCCCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H38F3N3O5/c1-2-6-21(18-30-20-9-11-22(12-10-20)37-26(27,28)29)31-25(34)36-23(17-19-7-4-3-5-8-19)24(33)32-13-15-35-16-14-32/h9-12,19,21,23,30H,2-8,13-18H2,1H3,(H,31,34)/t21-,23-/m0/s1 |
| InChIKey | IHLPNVVXUCBVBS-GMAHTHKFSA-N |
| XLogP | 5.09 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|