C9H20N2O3 — CID 23653061
azanium (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate (PubChem CID 23653061) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is azanium (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate.
| Compound Name | azanium (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 23653061 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | azanium (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate |
| SMILES | CC(C)C[C@H](CC(N)=O)CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C9H17NO3.H3N/c1-6(2)3-7(4-8(10)11)5-9(12)13;/h6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13);1H3/t7-;/m1./s1 |
| InChIKey | NIVBISVLIXBGPT-OGFXRTJISA-N |
| XLogP | 0.04 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |