C21H30N2O3 — CID 24753728
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 24753728) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 24753728 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | CC(C)C[C@H](CC(N)=O)CC(=O)[O-].C[C@H]([NH3+])c1cccc2ccccc12 |
| InChI | InChI=1S/C12H13N.C9H17NO3/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-6(2)3-7(4-8(10)11)5-9(12)13/h2-9H,13H2,1H3;6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t9-;7-/m01/s1 |
| InChIKey | UXURXDRXBPEVNZ-IRAZKAIOSA-N |
| XLogP | 1.81 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |