About (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 24753728) has the molecular formula C21H30N2O3
and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium.
Molecular Properties
| Compound Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium |
| PubChem CID | 24753728 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | CC(C)C[C@H](CC(N)=O)CC(=O)[O-].C[C@H]([NH3+])c1cccc2ccccc12 |
| InChI | InChI=1S/C12H13N.C9H17NO3/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-6(2)3-7(4-8(10)11)5-9(12)13/h2-9H,13H2,1H3;6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t9-;7-/m01/s1 |
| InChIKey | UXURXDRXBPEVNZ-IRAZKAIOSA-N |
| XLogP | 1.81 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium?
The IUPAC name of (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium (CID 24753728) is (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium.
What is the SMILES notation for (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium?
The canonical SMILES for (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium is CC(C)C[C@H](CC(N)=O)CC(=O)[O-].C[C@H]([NH3+])c1cccc2ccccc12.
What is the InChIKey of (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium?
The InChIKey is UXURXDRXBPEVNZ-IRAZKAIOSA-N. The full InChI is InChI=1S/C12H13N.C9H17NO3/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-6(2)3-7(4-8(10)11)5-9(12)13/h2-9H,13H2,1H3;6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t9-;7-/m01/s1.
What are the key properties of (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium?
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium has a molecular weight of 358.48 g/mol, XLogP of 1.81, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoate;[(1S)-1-naphthalen-1-ylethyl]azanium is sourced from PubChem (CID 24753728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).