C19H21N7O3 — CID 23660577
1-[[2-(4-amino-3-benzyl-5-oxo-1,2,4-triazol-1-yl)acetyl]amino]-3-benzylurea (PubChem CID 23660577) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-[[2-(4-amino-3-benzyl-5-oxo-1,2,4-triazol-1-yl)acetyl]amino]-3-benzylurea.
| Compound Name | 1-[[2-(4-amino-3-benzyl-5-oxo-1,2,4-triazol-1-yl)acetyl]amino]-3-benzylurea |
|---|---|
| PubChem CID | 23660577 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[[2-(4-amino-3-benzyl-5-oxo-1,2,4-triazol-1-yl)acetyl]amino]-3-benzylurea |
| SMILES | Nn1c(Cc2ccccc2)nn(CC(=O)NNC(=O)NCc2ccccc2)c1=O |
| InChI | InChI=1S/C19H21N7O3/c20-26-16(11-14-7-3-1-4-8-14)24-25(19(26)29)13-17(27)22-23-18(28)21-12-15-9-5-2-6-10-15/h1-10H,11-13,20H2,(H,22,27)(H2,21,23,28) |
| InChIKey | FFNFZQJMUPPAFS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|