C18H21N3O3 — CID 59015915
1-benzyl-3-[4-(4-hydroxyphenyl)butanoylamino]urea (PubChem CID 59015915) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-benzyl-3-[4-(4-hydroxyphenyl)butanoylamino]urea.
| Compound Name | 1-benzyl-3-[4-(4-hydroxyphenyl)butanoylamino]urea |
|---|---|
| PubChem CID | 59015915 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-benzyl-3-[4-(4-hydroxyphenyl)butanoylamino]urea |
| SMILES | O=C(CCCc1ccc(O)cc1)NNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H21N3O3/c22-16-11-9-14(10-12-16)7-4-8-17(23)20-21-18(24)19-13-15-5-2-1-3-6-15/h1-3,5-6,9-12,22H,4,7-8,13H2,(H,20,23)(H2,19,21,24) |
| InChIKey | VRSQLWSDOFMCKI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|