C10H12N6O2 — CID 1286105
2-(4-amino-5-oxo-3-phenyl-1,2,4-triazol-1-yl)acetohydrazide (PubChem CID 1286105) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-(4-amino-5-oxo-3-phenyl-1,2,4-triazol-1-yl)acetohydrazide.
| Compound Name | 2-(4-amino-5-oxo-3-phenyl-1,2,4-triazol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 1286105 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(4-amino-5-oxo-3-phenyl-1,2,4-triazol-1-yl)acetohydrazide |
| SMILES | NNC(=O)Cn1nc(-c2ccccc2)n(N)c1=O |
| InChI | InChI=1S/C10H12N6O2/c11-13-8(17)6-15-10(18)16(12)9(14-15)7-4-2-1-3-5-7/h1-5H,6,11-12H2,(H,13,17) |
| InChIKey | KORLOJIXQUJTFS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|