sodium naphthalen-2-olate

C10H7NaO — CID 23664630

IUPACsodium naphthalen-2-olate
SMILES[Na+].[O-]c1ccc2ccccc2c1
InChIInChI=1S/C10H8O.Na/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;/q;+1/p-1
InChIKeyAJXVJQAPXVDFBT-UHFFFAOYSA-M
MW166.15 g/mol
LogP-1.08
Rot. Bonds

About sodium naphthalen-2-olate

sodium naphthalen-2-olate (PubChem CID 23664630) has the molecular formula C10H7NaO and a molecular weight of 166.15 g/mol. Its IUPAC name is sodium naphthalen-2-olate.

Molecular Properties

Compound Namesodium naphthalen-2-olate
PubChem CID23664630
Molecular FormulaC10H7NaO
Molecular Weight166.15 g/mol
Exact Mass166.04
IUPAC Namesodium naphthalen-2-olate
SMILES[Na+].[O-]c1ccc2ccccc2c1
InChIInChI=1S/C10H8O.Na/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;/q;+1/p-1
InChIKeyAJXVJQAPXVDFBT-UHFFFAOYSA-M
XLogP-1.08
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.15
LogP ≤ 5-1.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium naphthalen-2-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium naphthalen-2-olate?
The IUPAC name of sodium naphthalen-2-olate (CID 23664630) is sodium naphthalen-2-olate.
What is the SMILES notation for sodium naphthalen-2-olate?
The canonical SMILES for sodium naphthalen-2-olate is [Na+].[O-]c1ccc2ccccc2c1.
What is the InChIKey of sodium naphthalen-2-olate?
The InChIKey is AJXVJQAPXVDFBT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8O.Na/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;/q;+1/p-1.
What are the key properties of sodium naphthalen-2-olate?
sodium naphthalen-2-olate has a molecular weight of 166.15 g/mol, XLogP of -1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium naphthalen-2-olate is sourced from PubChem (CID 23664630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).