About sodium naphthalen-2-olate
sodium naphthalen-2-olate (PubChem CID 23664630) has the molecular formula C10H7NaO
and a molecular weight of 166.15 g/mol. Its IUPAC name is sodium naphthalen-2-olate.
Molecular Properties
| Compound Name | sodium naphthalen-2-olate |
| PubChem CID | 23664630 |
| Molecular Formula | C10H7NaO |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | sodium naphthalen-2-olate |
| SMILES | [Na+].[O-]c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.Na/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;/q;+1/p-1 |
| InChIKey | AJXVJQAPXVDFBT-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium naphthalen-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium naphthalen-2-olate?
The IUPAC name of sodium naphthalen-2-olate (CID 23664630) is sodium naphthalen-2-olate.
What is the SMILES notation for sodium naphthalen-2-olate?
The canonical SMILES for sodium naphthalen-2-olate is [Na+].[O-]c1ccc2ccccc2c1.
What is the InChIKey of sodium naphthalen-2-olate?
The InChIKey is AJXVJQAPXVDFBT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8O.Na/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;/q;+1/p-1.
What are the key properties of sodium naphthalen-2-olate?
sodium naphthalen-2-olate has a molecular weight of 166.15 g/mol, XLogP of -1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium naphthalen-2-olate is sourced from PubChem (CID 23664630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).