About sodium prop-2-enylsulfanyl sulfate
sodium prop-2-enylsulfanyl sulfate (PubChem CID 23674984) has the molecular formula C3H5NaO4S2
and a molecular weight of 192.19 g/mol. Its IUPAC name is sodium prop-2-enylsulfanyl sulfate.
Molecular Properties
| Compound Name | sodium prop-2-enylsulfanyl sulfate |
| PubChem CID | 23674984 |
| Molecular Formula | C3H5NaO4S2 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 191.95 |
| IUPAC Name | sodium prop-2-enylsulfanyl sulfate |
| SMILES | C=CCSOS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O4S2.Na/c1-2-3-8-7-9(4,5)6;/h2H,1,3H2,(H,4,5,6);/q;+1/p-1 |
| InChIKey | IASZLYAOTVMVAS-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium prop-2-enylsulfanyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium prop-2-enylsulfanyl sulfate?
The IUPAC name of sodium prop-2-enylsulfanyl sulfate (CID 23674984) is sodium prop-2-enylsulfanyl sulfate.
What is the SMILES notation for sodium prop-2-enylsulfanyl sulfate?
The canonical SMILES for sodium prop-2-enylsulfanyl sulfate is C=CCSOS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium prop-2-enylsulfanyl sulfate?
The InChIKey is IASZLYAOTVMVAS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O4S2.Na/c1-2-3-8-7-9(4,5)6;/h2H,1,3H2,(H,4,5,6);/q;+1/p-1.
What are the key properties of sodium prop-2-enylsulfanyl sulfate?
sodium prop-2-enylsulfanyl sulfate has a molecular weight of 192.19 g/mol, XLogP of -2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium prop-2-enylsulfanyl sulfate is sourced from PubChem (CID 23674984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).