sodium methoxy-oxido-oxophosphanium

CH3NaO3P+ — CID 23678289

IUPACsodium methoxy-oxido-oxophosphanium
SMILESCO[P+](=O)[O-].[Na+]
InChIInChI=1S/CH3O3P.Na/c1-4-5(2)3;/h1H3;/q;+1
InChIKeyNYSUKUIWVFLKOS-UHFFFAOYSA-N
MW117.00 g/mol
LogP-3.35
Rot. Bonds1

About sodium methoxy-oxido-oxophosphanium

sodium methoxy-oxido-oxophosphanium (PubChem CID 23678289) has the molecular formula CH3NaO3P+ and a molecular weight of 117.00 g/mol. Its IUPAC name is sodium methoxy-oxido-oxophosphanium.

Molecular Properties

Compound Namesodium methoxy-oxido-oxophosphanium
PubChem CID23678289
Molecular FormulaCH3NaO3P+
Molecular Weight117.00 g/mol
Exact Mass116.97
IUPAC Namesodium methoxy-oxido-oxophosphanium
SMILESCO[P+](=O)[O-].[Na+]
InChIInChI=1S/CH3O3P.Na/c1-4-5(2)3;/h1H3;/q;+1
InChIKeyNYSUKUIWVFLKOS-UHFFFAOYSA-N
XLogP-3.35
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.00
LogP ≤ 5-3.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze sodium methoxy-oxido-oxophosphanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium methoxy-oxido-oxophosphanium?
The IUPAC name of sodium methoxy-oxido-oxophosphanium (CID 23678289) is sodium methoxy-oxido-oxophosphanium.
What is the SMILES notation for sodium methoxy-oxido-oxophosphanium?
The canonical SMILES for sodium methoxy-oxido-oxophosphanium is CO[P+](=O)[O-].[Na+].
What is the InChIKey of sodium methoxy-oxido-oxophosphanium?
The InChIKey is NYSUKUIWVFLKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3O3P.Na/c1-4-5(2)3;/h1H3;/q;+1.
What are the key properties of sodium methoxy-oxido-oxophosphanium?
sodium methoxy-oxido-oxophosphanium has a molecular weight of 117.00 g/mol, XLogP of -3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium methoxy-oxido-oxophosphanium is sourced from PubChem (CID 23678289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).