About zinc;methanol;oxido-oxo-phosphooxyphosphanium
zinc;methanol;oxido-oxo-phosphooxyphosphanium (PubChem CID 88679931) has the molecular formula CH4O6P2Zn+2
and a molecular weight of 239.38 g/mol. Its IUPAC name is zinc;methanol;oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | zinc;methanol;oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88679931 |
| Molecular Formula | CH4O6P2Zn+2 |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 237.88 |
| IUPAC Name | zinc;methanol;oxido-oxo-phosphooxyphosphanium |
| SMILES | CO.O=[P+]([O-])O[P+](=O)[O-].[Zn+2] |
| InChI | InChI=1S/CH4O.O5P2.Zn/c1-2;1-6(2)5-7(3)4;/h2H,1H3;;/q;;+2 |
| InChIKey | IPDNQTCKNYAFGB-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;methanol;oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;methanol;oxido-oxo-phosphooxyphosphanium?
The IUPAC name of zinc;methanol;oxido-oxo-phosphooxyphosphanium (CID 88679931) is zinc;methanol;oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for zinc;methanol;oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for zinc;methanol;oxido-oxo-phosphooxyphosphanium is CO.O=[P+]([O-])O[P+](=O)[O-].[Zn+2].
What is the InChIKey of zinc;methanol;oxido-oxo-phosphooxyphosphanium?
The InChIKey is IPDNQTCKNYAFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O.O5P2.Zn/c1-2;1-6(2)5-7(3)4;/h2H,1H3;;/q;;+2.
What are the key properties of zinc;methanol;oxido-oxo-phosphooxyphosphanium?
zinc;methanol;oxido-oxo-phosphooxyphosphanium has a molecular weight of 239.38 g/mol, XLogP of -1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;methanol;oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88679931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).