About 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver
2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver (PubChem CID 88679163) has the molecular formula C2H5AgClO6P2
and a molecular weight of 330.33 g/mol. Its IUPAC name is 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver.
Molecular Properties
| Compound Name | 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver |
| PubChem CID | 88679163 |
| Molecular Formula | C2H5AgClO6P2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 328.83 |
| IUPAC Name | 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver |
| SMILES | O=[P+]([O-])O[P+](=O)[O-].OCCCl.[Ag] |
| InChI | InChI=1S/C2H5ClO.Ag.O5P2/c3-1-2-4;;1-6(2)5-7(3)4/h4H,1-2H2;; |
| InChIKey | MFGWJMJYSHDJPA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver?
The IUPAC name of 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver (CID 88679163) is 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver.
What is the SMILES notation for 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver?
The canonical SMILES for 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver is O=[P+]([O-])O[P+](=O)[O-].OCCCl.[Ag].
What is the InChIKey of 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver?
The InChIKey is MFGWJMJYSHDJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5ClO.Ag.O5P2/c3-1-2-4;;1-6(2)5-7(3)4/h4H,1-2H2;;.
What are the key properties of 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver?
2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver has a molecular weight of 330.33 g/mol, XLogP of -0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethanol;oxido-oxo-phosphooxyphosphanium;silver is sourced from PubChem (CID 88679163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).