C2H4BaCl2O5P2+2 — CID 88680050
barium(2+);1,2-dichloroethane;oxido-oxo-phosphooxyphosphanium (PubChem CID 88680050) has the molecular formula C2H4BaCl2O5P2+2 and a molecular weight of 378.23 g/mol. Its IUPAC name is barium(2+);1,2-dichloroethane;oxido-oxo-phosphooxyphosphanium.
| Compound Name | barium(2+);1,2-dichloroethane;oxido-oxo-phosphooxyphosphanium |
|---|---|
| PubChem CID | 88680050 |
| Molecular Formula | C2H4BaCl2O5P2+2 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.80 |
| IUPAC Name | barium(2+);1,2-dichloroethane;oxido-oxo-phosphooxyphosphanium |
| SMILES | ClCCCl.O=[P+]([O-])O[P+](=O)[O-].[Ba+2] |
| InChI | InChI=1S/C2H4Cl2.Ba.O5P2/c3-1-2-4;;1-6(2)5-7(3)4/h1-2H2;;/q;+2; |
| InChIKey | OEFJXXZJXRJWPJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|