About beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium
beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium (PubChem CID 88722712) has the molecular formula CH3BeClO6P2+2
and a molecular weight of 217.44 g/mol. Its IUPAC name is beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88722712 |
| Molecular Formula | CH3BeClO6P2+2 |
| Molecular Weight | 217.44 g/mol |
| Exact Mass | 216.92 |
| IUPAC Name | beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium |
| SMILES | O=[P+]([O-])O[P+](=O)[O-].OCCl.[Be+2] |
| InChI | InChI=1S/CH3ClO.Be.O5P2/c2-1-3;;1-6(2)5-7(3)4/h3H,1H2;;/q;+2; |
| InChIKey | WKDORGSGRFWRTQ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.44 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium?
The IUPAC name of beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium (CID 88722712) is beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium is O=[P+]([O-])O[P+](=O)[O-].OCCl.[Be+2].
What is the InChIKey of beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium?
The InChIKey is WKDORGSGRFWRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3ClO.Be.O5P2/c2-1-3;;1-6(2)5-7(3)4/h3H,1H2;;/q;+2;.
What are the key properties of beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium?
beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium has a molecular weight of 217.44 g/mol, XLogP of -1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;chloromethanol;oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88722712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).