C19H12Cl3N3O — CID 2369260
(3E)-6-chloro-3-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]-1H-indol-2-one (PubChem CID 2369260) has the molecular formula C19H12Cl3N3O and a molecular weight of 404.68 g/mol. Its IUPAC name is (3E)-6-chloro-3-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2369260 |
| Molecular Formula | C19H12Cl3N3O |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | (3E)-6-chloro-3-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1/C=C1/C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H12Cl3N3O/c1-10-15(18(22)25(24-10)13-4-2-3-11(20)7-13)9-16-14-6-5-12(21)8-17(14)23-19(16)26/h2-9H,1H3,(H,23,26)/b16-9+ |
| InChIKey | WKIKWTLDMXUYEB-CXUHLZMHSA-N |
| XLogP | 5.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|