C19H25NO3S — CID 23695
2-(2-benzhydrylsulfonylethoxy)-N,N-dimethylethanamine (PubChem CID 23695) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-(2-benzhydrylsulfonylethoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(2-benzhydrylsulfonylethoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23695 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(2-benzhydrylsulfonylethoxy)-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCCS(=O)(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3S/c1-20(2)13-14-23-15-16-24(21,22)19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3 |
| InChIKey | IOEBXHQDIULCMA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|