About potassium 2-benzylselanylacetate
potassium 2-benzylselanylacetate (PubChem CID 23697851) has the molecular formula C9H9KO2Se
and a molecular weight of 267.23 g/mol. Its IUPAC name is potassium 2-benzylselanylacetate.
Molecular Properties
| Compound Name | potassium 2-benzylselanylacetate |
| PubChem CID | 23697851 |
| Molecular Formula | C9H9KO2Se |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | potassium 2-benzylselanylacetate |
| SMILES | O=C([O-])C[Se]Cc1ccccc1.[K+] |
| InChI | InChI=1S/C9H10O2Se.K/c10-9(11)7-12-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H,10,11);/q;+1/p-1 |
| InChIKey | LWIVQNFQTALDIW-UHFFFAOYSA-M |
| XLogP | -2.94 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-benzylselanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-benzylselanylacetate?
The IUPAC name of potassium 2-benzylselanylacetate (CID 23697851) is potassium 2-benzylselanylacetate.
What is the SMILES notation for potassium 2-benzylselanylacetate?
The canonical SMILES for potassium 2-benzylselanylacetate is O=C([O-])C[Se]Cc1ccccc1.[K+].
What is the InChIKey of potassium 2-benzylselanylacetate?
The InChIKey is LWIVQNFQTALDIW-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O2Se.K/c10-9(11)7-12-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 2-benzylselanylacetate?
potassium 2-benzylselanylacetate has a molecular weight of 267.23 g/mol, XLogP of -2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-benzylselanylacetate is sourced from PubChem (CID 23697851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).