C16H11KO8S2 — CID 23702039
potassium 5,7-bis(methylsulfonyl)-9-oxoxanthene-2-carboxylate (PubChem CID 23702039) has the molecular formula C16H11KO8S2 and a molecular weight of 434.49 g/mol. Its IUPAC name is potassium 5,7-bis(methylsulfonyl)-9-oxoxanthene-2-carboxylate.
| Compound Name | potassium 5,7-bis(methylsulfonyl)-9-oxoxanthene-2-carboxylate |
|---|---|
| PubChem CID | 23702039 |
| Molecular Formula | C16H11KO8S2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | potassium 5,7-bis(methylsulfonyl)-9-oxoxanthene-2-carboxylate |
| SMILES | CS(=O)(=O)c1cc(S(C)(=O)=O)c2oc3ccc(C(=O)[O-])cc3c(=O)c2c1.[K+] |
| InChI | InChI=1S/C16H12O8S2.K/c1-25(20,21)9-6-11-14(17)10-5-8(16(18)19)3-4-12(10)24-15(11)13(7-9)26(2,22)23;/h3-7H,1-2H3,(H,18,19);/q;+1/p-1 |
| InChIKey | UXJXEZYJFMULCH-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 138.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|