About lithium fluoro hexyl phosphate
lithium fluoro hexyl phosphate (PubChem CID 23706071) has the molecular formula C6H13FLiO4P
and a molecular weight of 206.08 g/mol. Its IUPAC name is lithium fluoro hexyl phosphate.
Molecular Properties
| Compound Name | lithium fluoro hexyl phosphate |
| PubChem CID | 23706071 |
| Molecular Formula | C6H13FLiO4P |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | lithium fluoro hexyl phosphate |
| SMILES | CCCCCCOP(=O)([O-])OF.[Li+] |
| InChI | InChI=1S/C6H14FO4P.Li/c1-2-3-4-5-6-10-12(8,9)11-7;/h2-6H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | FIQIGTLWAFXVLP-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium fluoro hexyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium fluoro hexyl phosphate?
The IUPAC name of lithium fluoro hexyl phosphate (CID 23706071) is lithium fluoro hexyl phosphate.
What is the SMILES notation for lithium fluoro hexyl phosphate?
The canonical SMILES for lithium fluoro hexyl phosphate is CCCCCCOP(=O)([O-])OF.[Li+].
What is the InChIKey of lithium fluoro hexyl phosphate?
The InChIKey is FIQIGTLWAFXVLP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14FO4P.Li/c1-2-3-4-5-6-10-12(8,9)11-7;/h2-6H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of lithium fluoro hexyl phosphate?
lithium fluoro hexyl phosphate has a molecular weight of 206.08 g/mol, XLogP of -1.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium fluoro hexyl phosphate is sourced from PubChem (CID 23706071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).