C33H43N2NaO6S — CID 23708727
sodium (2S)-2-[[4-[[1-(1-cyclohexylpyrrolidin-2-yl)-2-methoxy-2-oxoethoxy]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 23708727) has the molecular formula C33H43N2NaO6S and a molecular weight of 618.77 g/mol. Its IUPAC name is sodium (2S)-2-[[4-[[1-(1-cyclohexylpyrrolidin-2-yl)-2-methoxy-2-oxoethoxy]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | sodium (2S)-2-[[4-[[1-(1-cyclohexylpyrrolidin-2-yl)-2-methoxy-2-oxoethoxy]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 23708727 |
| Molecular Formula | C33H43N2NaO6S |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | sodium (2S)-2-[[4-[[1-(1-cyclohexylpyrrolidin-2-yl)-2-methoxy-2-oxoethoxy]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(OCc1ccc(C(=O)N[C@@H](CCSC)C(=O)[O-])c(-c2ccccc2C)c1)C1CCCN1C1CCCCC1.[Na+] |
| InChI | InChI=1S/C33H44N2O6S.Na/c1-22-10-7-8-13-25(22)27-20-23(15-16-26(27)31(36)34-28(32(37)38)17-19-42-3)21-41-30(33(39)40-2)29-14-9-18-35(29)24-11-5-4-6-12-24;/h7-8,10,13,15-16,20,24,28-30H,4-6,9,11-12,14,17-19,21H2,1-3H3,(H,34,36)(H,37,38);/q;+1/p-1/t28-,29?,30?;/m0./s1 |
| InChIKey | BZIXIXKRMDEQBG-CYWXJVENSA-M |
| XLogP | 1.12 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |