C14H11KO7S — CID 23709227
potassium 2,6-bis(methoxycarbonyl)naphthalene-1-sulfonate (PubChem CID 23709227) has the molecular formula C14H11KO7S and a molecular weight of 362.40 g/mol. Its IUPAC name is potassium 2,6-bis(methoxycarbonyl)naphthalene-1-sulfonate.
| Compound Name | potassium 2,6-bis(methoxycarbonyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 23709227 |
| Molecular Formula | C14H11KO7S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | potassium 2,6-bis(methoxycarbonyl)naphthalene-1-sulfonate |
| SMILES | COC(=O)c1ccc2c(S(=O)(=O)[O-])c(C(=O)OC)ccc2c1.[K+] |
| InChI | InChI=1S/C14H12O7S.K/c1-20-13(15)9-4-5-10-8(7-9)3-6-11(14(16)21-2)12(10)22(17,18)19;/h3-7H,1-2H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | RKIOXTNBGSJMCH-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|