potassium 2-(4-fluoroanilino)acetate

C8H7FKNO2 — CID 23714846

IUPACpotassium 2-(4-fluoroanilino)acetate
SMILESO=C([O-])CNc1ccc(F)cc1.[K+]
InChIInChI=1S/C8H8FNO2.K/c9-6-1-3-7(4-2-6)10-5-8(11)12;/h1-4,10H,5H2,(H,11,12);/q;+1/p-1
InChIKeyRZMJGBZRIUQCKK-UHFFFAOYSA-M
MW207.25 g/mol
LogP-3.01
Rot. Bonds3

About potassium 2-(4-fluoroanilino)acetate

potassium 2-(4-fluoroanilino)acetate (PubChem CID 23714846) has the molecular formula C8H7FKNO2 and a molecular weight of 207.25 g/mol. Its IUPAC name is potassium 2-(4-fluoroanilino)acetate.

Molecular Properties

Compound Namepotassium 2-(4-fluoroanilino)acetate
PubChem CID23714846
Molecular FormulaC8H7FKNO2
Molecular Weight207.25 g/mol
Exact Mass207.01
IUPAC Namepotassium 2-(4-fluoroanilino)acetate
SMILESO=C([O-])CNc1ccc(F)cc1.[K+]
InChIInChI=1S/C8H8FNO2.K/c9-6-1-3-7(4-2-6)10-5-8(11)12;/h1-4,10H,5H2,(H,11,12);/q;+1/p-1
InChIKeyRZMJGBZRIUQCKK-UHFFFAOYSA-M
XLogP-3.01
TPSA52.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 5-3.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze potassium 2-(4-fluoroanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-(4-fluoroanilino)acetate?
The IUPAC name of potassium 2-(4-fluoroanilino)acetate (CID 23714846) is potassium 2-(4-fluoroanilino)acetate.
What is the SMILES notation for potassium 2-(4-fluoroanilino)acetate?
The canonical SMILES for potassium 2-(4-fluoroanilino)acetate is O=C([O-])CNc1ccc(F)cc1.[K+].
What is the InChIKey of potassium 2-(4-fluoroanilino)acetate?
The InChIKey is RZMJGBZRIUQCKK-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8FNO2.K/c9-6-1-3-7(4-2-6)10-5-8(11)12;/h1-4,10H,5H2,(H,11,12);/q;+1/p-1.
What are the key properties of potassium 2-(4-fluoroanilino)acetate?
potassium 2-(4-fluoroanilino)acetate has a molecular weight of 207.25 g/mol, XLogP of -3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-(4-fluoroanilino)acetate is sourced from PubChem (CID 23714846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).