potassium 5-aminotetrazole-1-carboxylate

C2H2KN5O2 — CID 23715559

IUPACpotassium 5-aminotetrazole-1-carboxylate
SMILESNc1nnnn1C(=O)[O-].[K+]
InChIInChI=1S/C2H3N5O2.K/c3-1-4-5-6-7(1)2(8)9;/h(H,8,9)(H2,3,4,6);/q;+1/p-1
InChIKeyMPCQKZZDIRKEEW-UHFFFAOYSA-M
MW167.17 g/mol
LogP-5.55
Rot. Bonds

About potassium 5-aminotetrazole-1-carboxylate

potassium 5-aminotetrazole-1-carboxylate (PubChem CID 23715559) has the molecular formula C2H2KN5O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is potassium 5-aminotetrazole-1-carboxylate.

Molecular Properties

Compound Namepotassium 5-aminotetrazole-1-carboxylate
PubChem CID23715559
Molecular FormulaC2H2KN5O2
Molecular Weight167.17 g/mol
Exact Mass166.98
IUPAC Namepotassium 5-aminotetrazole-1-carboxylate
SMILESNc1nnnn1C(=O)[O-].[K+]
InChIInChI=1S/C2H3N5O2.K/c3-1-4-5-6-7(1)2(8)9;/h(H,8,9)(H2,3,4,6);/q;+1/p-1
InChIKeyMPCQKZZDIRKEEW-UHFFFAOYSA-M
XLogP-5.55
TPSA109.75 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.17
LogP ≤ 5-5.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'amidotetrazole', 'substructure': 'N/A'}

Analyze potassium 5-aminotetrazole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 5-aminotetrazole-1-carboxylate?
The IUPAC name of potassium 5-aminotetrazole-1-carboxylate (CID 23715559) is potassium 5-aminotetrazole-1-carboxylate.
What is the SMILES notation for potassium 5-aminotetrazole-1-carboxylate?
The canonical SMILES for potassium 5-aminotetrazole-1-carboxylate is Nc1nnnn1C(=O)[O-].[K+].
What is the InChIKey of potassium 5-aminotetrazole-1-carboxylate?
The InChIKey is MPCQKZZDIRKEEW-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3N5O2.K/c3-1-4-5-6-7(1)2(8)9;/h(H,8,9)(H2,3,4,6);/q;+1/p-1.
What are the key properties of potassium 5-aminotetrazole-1-carboxylate?
potassium 5-aminotetrazole-1-carboxylate has a molecular weight of 167.17 g/mol, XLogP of -5.55, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-aminotetrazole-1-carboxylate is sourced from PubChem (CID 23715559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).