C27H35FN2O — CID 23723545
4-[4-[[ethyl-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]amino]methyl]phenyl]but-3-yn-1-ol (PubChem CID 23723545) has the molecular formula C27H35FN2O and a molecular weight of 422.59 g/mol. Its IUPAC name is 4-[4-[[ethyl-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]amino]methyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-[[ethyl-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]amino]methyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 23723545 |
| Molecular Formula | C27H35FN2O |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-[4-[[ethyl-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]amino]methyl]phenyl]but-3-yn-1-ol |
| SMILES | CCN(Cc1ccc(C#CCCO)cc1)CC1CCCN(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C27H35FN2O/c1-2-29(20-25-13-11-23(12-14-25)7-3-4-18-31)21-26-9-6-16-30(22-26)17-15-24-8-5-10-27(28)19-24/h5,8,10-14,19,26,31H,2,4,6,9,15-18,20-22H2,1H3 |
| InChIKey | ULVJKEJNMYXWNC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|