C20H29FN4 — CID 45230318
N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N-(1H-pyrazol-5-ylmethyl)ethanamine (PubChem CID 45230318) has the molecular formula C20H29FN4 and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N-(1H-pyrazol-5-ylmethyl)ethanamine.
| Compound Name | N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N-(1H-pyrazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 45230318 |
| Molecular Formula | C20H29FN4 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N-(1H-pyrazol-5-ylmethyl)ethanamine |
| SMILES | CCN(Cc1ccn[nH]1)CC1CCCN(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H29FN4/c1-2-24(16-20-8-10-22-23-20)14-18-6-4-11-25(15-18)12-9-17-5-3-7-19(21)13-17/h3,5,7-8,10,13,18H,2,4,6,9,11-12,14-16H2,1H3,(H,22,23) |
| InChIKey | IHGAUWAHILOEJZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |