C18H19N3O2 — CID 23725525
[1-(1H-indol-6-ylmethyl)piperidin-4-yl]-(1,3-oxazol-2-yl)methanone (PubChem CID 23725525) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is [1-(1H-indol-6-ylmethyl)piperidin-4-yl]-(1,3-oxazol-2-yl)methanone.
| Compound Name | [1-(1H-indol-6-ylmethyl)piperidin-4-yl]-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 23725525 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [1-(1H-indol-6-ylmethyl)piperidin-4-yl]-(1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncco1)C1CCN(Cc2ccc3cc[nH]c3c2)CC1 |
| InChI | InChI=1S/C18H19N3O2/c22-17(18-20-7-10-23-18)15-4-8-21(9-5-15)12-13-1-2-14-3-6-19-16(14)11-13/h1-3,6-7,10-11,15,19H,4-5,8-9,12H2 |
| InChIKey | KOZVYDWQVDJAKX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |