C9H13ClN2O2 — CID 68771759
1,3-oxazol-2-yl(piperidin-4-yl)methanone;hydrochloride (PubChem CID 68771759) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 1,3-oxazol-2-yl(piperidin-4-yl)methanone;hydrochloride.
| Compound Name | 1,3-oxazol-2-yl(piperidin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 68771759 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1,3-oxazol-2-yl(piperidin-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ncco1)C1CCNCC1 |
| InChI | InChI=1S/C9H12N2O2.ClH/c12-8(9-11-5-6-13-9)7-1-3-10-4-2-7;/h5-7,10H,1-4H2;1H |
| InChIKey | CVNCLCKBLWGXEV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |