C27H44N2O6 — CID 23725770
oxan-4-yl N-[(3S,4R)-4-[(2R)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]pyrrolidin-3-yl]carbamate (PubChem CID 23725770) has the molecular formula C27H44N2O6 and a molecular weight of 492.66 g/mol. Its IUPAC name is oxan-4-yl N-[(3S,4R)-4-[(2R)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]pyrrolidin-3-yl]carbamate.
| Compound Name | oxan-4-yl N-[(3S,4R)-4-[(2R)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 23725770 |
| Molecular Formula | C27H44N2O6 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | oxan-4-yl N-[(3S,4R)-4-[(2R)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3-methylbutyl]pyrrolidin-3-yl]carbamate |
| SMILES | COCCCOc1cc(C[C@@H](C[C@@H]2CNC[C@H]2NC(=O)OC2CCOCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C27H44N2O6/c1-19(2)21(14-20-6-7-25(32-4)26(15-20)34-11-5-10-31-3)16-22-17-28-18-24(22)29-27(30)35-23-8-12-33-13-9-23/h6-7,15,19,21-24,28H,5,8-14,16-18H2,1-4H3,(H,29,30)/t21-,22+,24+/m0/s1 |
| InChIKey | LOTLPCFDCLQBJC-WMTXJRDZSA-N |
| XLogP | 3.81 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|