C13H32NO9P3 — CID 23727445
2-methyl-N-[1,3,3-tris(dimethoxyphosphoryl)propyl]propan-2-amine (PubChem CID 23727445) has the molecular formula C13H32NO9P3 and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-methyl-N-[1,3,3-tris(dimethoxyphosphoryl)propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[1,3,3-tris(dimethoxyphosphoryl)propyl]propan-2-amine |
|---|---|
| PubChem CID | 23727445 |
| Molecular Formula | C13H32NO9P3 |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-methyl-N-[1,3,3-tris(dimethoxyphosphoryl)propyl]propan-2-amine |
| SMILES | COP(=O)(OC)C(CC(P(=O)(OC)OC)P(=O)(OC)OC)NC(C)(C)C |
| InChI | InChI=1S/C13H32NO9P3/c1-13(2,3)14-11(24(15,18-4)19-5)10-12(25(16,20-6)21-7)26(17,22-8)23-9/h11-12,14H,10H2,1-9H3 |
| InChIKey | YQIDACHUFWUNSD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|