C12H28NO2P — CID 91369124
N-tert-butyl-1-[ethoxy(methyl)phosphoryl]-2,2-dimethylpropan-1-amine (PubChem CID 91369124) has the molecular formula C12H28NO2P and a molecular weight of 249.33 g/mol. Its IUPAC name is N-tert-butyl-1-[ethoxy(methyl)phosphoryl]-2,2-dimethylpropan-1-amine.
| Compound Name | N-tert-butyl-1-[ethoxy(methyl)phosphoryl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 91369124 |
| Molecular Formula | C12H28NO2P |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-tert-butyl-1-[ethoxy(methyl)phosphoryl]-2,2-dimethylpropan-1-amine |
| SMILES | CCOP(C)(=O)C(NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H28NO2P/c1-9-15-16(8,14)10(11(2,3)4)13-12(5,6)7/h10,13H,9H2,1-8H3 |
| InChIKey | ASBPMTXBWRSOKB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|