About 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide
2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide (PubChem CID 23727577) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide.
Molecular Properties
| Compound Name | 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide |
| PubChem CID | 23727577 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide |
| SMILES | O=C(Cc1cccc[n+]1[O-])N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O2/c22-19(15-18-13-7-8-14-20(18)23)21(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2 |
| InChIKey | RCFPRLYKNXGITP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide?
The IUPAC name of 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide (CID 23727577) is 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide.
What is the SMILES notation for 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide?
The canonical SMILES for 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide is O=C(Cc1cccc[n+]1[O-])N(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide?
The InChIKey is RCFPRLYKNXGITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2/c22-19(15-18-13-7-8-14-20(18)23)21(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2.
What are the key properties of 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide?
2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide has a molecular weight of 304.35 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxidopyridin-1-ium-2-yl)-N,N-diphenylacetamide is sourced from PubChem (CID 23727577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).