C35H41ClO3Si — CID 23746621
4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-ethylbut-1-enyl]-3-chlorophenol (PubChem CID 23746621) has the molecular formula C35H41ClO3Si and a molecular weight of 573.25 g/mol. Its IUPAC name is 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-ethylbut-1-enyl]-3-chlorophenol.
| Compound Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-ethylbut-1-enyl]-3-chlorophenol |
|---|---|
| PubChem CID | 23746621 |
| Molecular Formula | C35H41ClO3Si |
| Molecular Weight | 573.25 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-ethylbut-1-enyl]-3-chlorophenol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1=CCOC1CC/C(=C/c1ccc(O)cc1Cl)CC |
| InChI | InChI=1S/C35H41ClO3Si/c1-6-27(23-28-18-19-29(37)24-33(28)36)17-20-34-32(21-22-38-34)26(2)25-39-40(35(3,4)5,30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-16,18-19,21,23-24,34,37H,2,6,17,20,22,25H2,1,3-5H3/b27-23+ |
| InChIKey | LUEZNSDFNXMROO-SLEBQGDGSA-N |
| XLogP | 8.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.25 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|