C34H39BrO3Si — CID 23862038
4-bromo-2-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol (PubChem CID 23862038) has the molecular formula C34H39BrO3Si and a molecular weight of 603.67 g/mol. Its IUPAC name is 4-bromo-2-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol.
| Compound Name | 4-bromo-2-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23862038 |
| Molecular Formula | C34H39BrO3Si |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 4-bromo-2-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1=CCOC1CC/C(C)=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C34H39BrO3Si/c1-25(22-27-23-28(35)17-18-32(27)36)16-19-33-31(20-21-37-33)26(2)24-38-39(34(3,4)5,29-12-8-6-9-13-29)30-14-10-7-11-15-30/h6-15,17-18,20,22-23,33,36H,2,16,19,21,24H2,1,3-5H3/b25-22+ |
| InChIKey | CTAUSZCVCYYDGT-YYDJUVGSSA-N |
| XLogP | 7.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|