C34H40O3Si — CID 23728259
4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol (PubChem CID 23728259) has the molecular formula C34H40O3Si and a molecular weight of 524.78 g/mol. Its IUPAC name is 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol.
| Compound Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23728259 |
| Molecular Formula | C34H40O3Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 4-[(E)-4-[3-[3-[tert-butyl(diphenyl)silyl]oxyprop-1-en-2-yl]-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]phenol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1=CCOC1CC/C(C)=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C34H40O3Si/c1-26(24-28-17-19-29(35)20-18-28)16-21-33-32(22-23-36-33)27(2)25-37-38(34(3,4)5,30-12-8-6-9-13-30)31-14-10-7-11-15-31/h6-15,17-20,22,24,33,35H,2,16,21,23,25H2,1,3-5H3/b26-24+ |
| InChIKey | PABZVUZBLPCKKO-SHHOIMCASA-N |
| XLogP | 7.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|